C21H29NO3 — CID 56838225
(3E,4aR,6aR,11aR,11bR)-3-hydroxyimino-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluorene-7,9-diol (PubChem CID 56838225) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3E,4aR,6aR,11aR,11bR)-3-hydroxyimino-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluorene-7,9-diol.
| Compound Name | (3E,4aR,6aR,11aR,11bR)-3-hydroxyimino-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluorene-7,9-diol |
|---|---|
| PubChem CID | 56838225 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (3E,4aR,6aR,11aR,11bR)-3-hydroxyimino-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluorene-7,9-diol |
| SMILES | CC1(C)/C(=N/O)CC[C@]2(C)[C@H]3Cc4cc(O)cc(O)c4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H29NO3/c1-19(2)15-5-7-21(4)16(20(15,3)8-6-17(19)22-25)10-12-9-13(23)11-14(24)18(12)21/h9,11,15-16,23-25H,5-8,10H2,1-4H3/b22-17+/t15-,16+,20-,21+/m0/s1 |
| InChIKey | KEEBLZXRKFYBOM-OAIFFWINSA-N |
| XLogP | 4.59 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|