C30H47NO3 — CID 95795348
(1S,4R,5R,8S,10Z,13R,14R,17R,18S,19S)-10-hydroxyimino-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one (PubChem CID 95795348) has the molecular formula C30H47NO3 and a molecular weight of 469.71 g/mol. Its IUPAC name is (1S,4R,5R,8S,10Z,13R,14R,17R,18S,19S)-10-hydroxyimino-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one.
| Compound Name | (1S,4R,5R,8S,10Z,13R,14R,17R,18S,19S)-10-hydroxyimino-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one |
|---|---|
| PubChem CID | 95795348 |
| Molecular Formula | C30H47NO3 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.36 |
| IUPAC Name | (1S,4R,5R,8S,10Z,13R,14R,17R,18S,19S)-10-hydroxyimino-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one |
| SMILES | CC1(C)CC[C@@]23CC[C@]4(C)[C@H](CC[C@@H]5[C@@]6(C)CC/C(=N/O)C(C)(C)[C@H]6CC[C@]54C)[C@@H]2[C@@H]1OC3=O |
| InChI | InChI=1S/C30H47NO3/c1-25(2)14-16-30-17-15-28(6)18(22(30)23(25)34-24(30)32)8-9-20-27(5)12-11-21(31-33)26(3,4)19(27)10-13-29(20,28)7/h18-20,22-23,33H,8-17H2,1-7H3/b31-21-/t18-,19-,20-,22-,23+,27+,28-,29-,30-/m1/s1 |
| InChIKey | HYYIFEJGPOPWTL-IMVCCRGLSA-N |
| XLogP | 7.23 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|