C32H50O2 — CID 59883755
(4R,5R,13S)-10-ethenyl-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one (PubChem CID 59883755) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is (4R,5R,13S)-10-ethenyl-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one.
| Compound Name | (4R,5R,13S)-10-ethenyl-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one |
|---|---|
| PubChem CID | 59883755 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | (4R,5R,13S)-10-ethenyl-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-23-one |
| SMILES | C=CC1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4C5OC(=O)C4(CCC5(C)C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C32H50O2/c1-9-20-12-14-29(6)22(28(20,4)5)13-15-31(8)23(29)11-10-21-24-25-27(2,3)16-18-32(24,26(33)34-25)19-17-30(21,31)7/h9,20-25H,1,10-19H2,2-8H3/t20?,21?,22?,23?,24?,25?,29-,30+,31+,32?/m0/s1 |
| InChIKey | JJXJXGFTNCRMOV-DUHUDTPASA-N |
| XLogP | 8.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|