C30H48N2O3 — CID 164889073
N'-hydroxy-3-[(1R,4R,5R,8S,9S,10R,13R,14R,15R)-4,5,9,16,16-pentamethyl-19-oxo-8-prop-1-en-2-yl-20-oxapentacyclo[13.3.2.01,14.04,13.05,10]icosan-9-yl]propanimidamide (PubChem CID 164889073) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is N'-hydroxy-3-[(1R,4R,5R,8S,9S,10R,13R,14R,15R)-4,5,9,16,16-pentamethyl-19-oxo-8-prop-1-en-2-yl-20-oxapentacyclo[13.3.2.01,14.04,13.05,10]icosan-9-yl]propanimidamide.
| Compound Name | N'-hydroxy-3-[(1R,4R,5R,8S,9S,10R,13R,14R,15R)-4,5,9,16,16-pentamethyl-19-oxo-8-prop-1-en-2-yl-20-oxapentacyclo[13.3.2.01,14.04,13.05,10]icosan-9-yl]propanimidamide |
|---|---|
| PubChem CID | 164889073 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | N'-hydroxy-3-[(1R,4R,5R,8S,9S,10R,13R,14R,15R)-4,5,9,16,16-pentamethyl-19-oxo-8-prop-1-en-2-yl-20-oxapentacyclo[13.3.2.01,14.04,13.05,10]icosan-9-yl]propanimidamide |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)[C@H](CC[C@@H]3[C@H]4[C@H]5OC(=O)[C@@]4(CCC5(C)C)CC[C@]32C)[C@@]1(C)CC/C(N)=N/O |
| InChI | InChI=1S/C30H48N2O3/c1-18(2)19-10-13-29(7)21(27(19,5)12-11-22(31)32-34)9-8-20-23-24-26(3,4)14-16-30(23,25(33)35-24)17-15-28(20,29)6/h19-21,23-24,34H,1,8-17H2,2-7H3,(H2,31,32)/t19-,20+,21+,23-,24+,27-,28+,29+,30-/m0/s1 |
| InChIKey | CXNNDRZUOXGRAU-WYOQCCBPSA-N |
| XLogP | 6.69 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|