C30H44O4 — CID 91259620
(4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosane-10,11,23-trione (PubChem CID 91259620) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosane-10,11,23-trione.
| Compound Name | (4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosane-10,11,23-trione |
|---|---|
| PubChem CID | 91259620 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (4R,5R,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosane-10,11,23-trione |
| SMILES | CC1(C)CCC23CC[C@]4(C)C(CCC5[C@@]6(C)CC(=O)C(=O)C(C)(C)C6CC[C@]54C)C2C1OC3=O |
| InChI | InChI=1S/C30H44O4/c1-25(2)12-14-30-15-13-28(6)17(21(30)23(25)34-24(30)33)8-9-20-27(5)16-18(31)22(32)26(3,4)19(27)10-11-29(20,28)7/h17,19-21,23H,8-16H2,1-7H3/t17?,19?,20?,21?,23?,27-,28+,29+,30?/m0/s1 |
| InChIKey | KIKHGKYTUJXUSF-SGAXNRSOSA-N |
| XLogP | 6.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|