C21H28O3 — CID 122432095
(6aS,11aS,11bS)-7,9-dihydroxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one (PubChem CID 122432095) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (6aS,11aS,11bS)-7,9-dihydroxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one.
| Compound Name | (6aS,11aS,11bS)-7,9-dihydroxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one |
|---|---|
| PubChem CID | 122432095 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (6aS,11aS,11bS)-7,9-dihydroxy-4,4,6a,11b-tetramethyl-2,4a,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-3-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C1CC[C@]1(C)c3c(O)cc(O)cc3C[C@H]12 |
| InChI | InChI=1S/C21H28O3/c1-19(2)15-5-7-21(4)16(20(15,3)8-6-17(19)24)10-12-9-13(22)11-14(23)18(12)21/h9,11,15-16,22-23H,5-8,10H2,1-4H3/t15?,16-,20+,21-/m0/s1 |
| InChIKey | RASBSRVZPHPPCV-CAEAKDIWSA-N |
| XLogP | 4.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |