C39H59NO5S — CID 46704376
[(1S,6R,8R,11R,12S,15S,16R,19S,21R)-19-methoxy-1,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 46704376) has the molecular formula C39H59NO5S and a molecular weight of 653.97 g/mol. Its IUPAC name is [(1S,6R,8R,11R,12S,15S,16R,19S,21R)-19-methoxy-1,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(1S,6R,8R,11R,12S,15S,16R,19S,21R)-19-methoxy-1,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 46704376 |
| Molecular Formula | C39H59NO5S |
| Molecular Weight | 653.97 g/mol |
| Exact Mass | 653.41 |
| IUPAC Name | [(1S,6R,8R,11R,12S,15S,16R,19S,21R)-19-methoxy-1,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-enyl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@@H](CC[C@@]3(C)CC4=CC[C@H]5C(C)(C)[C@H](OC(=O)NS(=O)(=O)c6ccc(C)cc6)CC[C@]5(C)[C@H]4CC[C@@H]32)C1(C)C |
| InChI | InChI=1S/C39H59NO5S/c1-25-10-13-27(14-11-25)46(42,43)40-34(41)45-33-20-22-38(7)28-15-17-31-37(6,24-26(28)12-16-29(38)36(33,4)5)21-18-30-35(2,3)32(44-9)19-23-39(30,31)8/h10-14,28-33H,15-24H2,1-9H3,(H,40,41)/t28-,29-,30-,31-,32-,33+,37-,38+,39-/m0/s1 |
| InChIKey | CFIOLHIOKBZLSP-XWPNVZLMSA-N |
| XLogP | 9.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.97 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|