C20H34O5 — CID 71530218
2-[(2R,4aR,4bS,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4b,8-dimethyl-1,2,3,4,4a,5,6,7,8a,9-decahydrophenanthren-2-yl]propane-1,2,3-triol (PubChem CID 71530218) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[(2R,4aR,4bS,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4b,8-dimethyl-1,2,3,4,4a,5,6,7,8a,9-decahydrophenanthren-2-yl]propane-1,2,3-triol.
| Compound Name | 2-[(2R,4aR,4bS,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4b,8-dimethyl-1,2,3,4,4a,5,6,7,8a,9-decahydrophenanthren-2-yl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 71530218 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-[(2R,4aR,4bS,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4b,8-dimethyl-1,2,3,4,4a,5,6,7,8a,9-decahydrophenanthren-2-yl]propane-1,2,3-triol |
| SMILES | C[C@]1(CO)[C@H]2CC=C3C[C@H](C(O)(CO)CO)CC[C@H]3[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-18-8-7-17(24)19(2,10-21)16(18)6-3-13-9-14(4-5-15(13)18)20(25,11-22)12-23/h3,14-17,21-25H,4-12H2,1-2H3/t14-,15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | ZXLKZAPTNGSJET-QKDSSNGWSA-N |
| XLogP | 1.22 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|