C20H32O4 — CID 71530219
(1S,2R,4aS,4bR,6S,7R,10aS)-1-(hydroxymethyl)-7-(3-hydroxyprop-1-en-2-yl)-1,4a-dimethyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-2,6-diol (PubChem CID 71530219) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,2R,4aS,4bR,6S,7R,10aS)-1-(hydroxymethyl)-7-(3-hydroxyprop-1-en-2-yl)-1,4a-dimethyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-2,6-diol.
| Compound Name | (1S,2R,4aS,4bR,6S,7R,10aS)-1-(hydroxymethyl)-7-(3-hydroxyprop-1-en-2-yl)-1,4a-dimethyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-2,6-diol |
|---|---|
| PubChem CID | 71530219 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,2R,4aS,4bR,6S,7R,10aS)-1-(hydroxymethyl)-7-(3-hydroxyprop-1-en-2-yl)-1,4a-dimethyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-2,6-diol |
| SMILES | C=C(CO)[C@H]1CC2=CC[C@@H]3[C@@](C)(CO)[C@H](O)CC[C@@]3(C)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C20H32O4/c1-12(10-21)14-8-13-4-5-17-19(2,15(13)9-16(14)23)7-6-18(24)20(17,3)11-22/h4,14-18,21-24H,1,5-11H2,2-3H3/t14-,15-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | VJVZOSZFDKSLNA-KSLKBLKXSA-N |
| XLogP | 2.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|