C20H32O5 — CID 56628671
(3R,4aS,5R,6S,6aS,10S,10aS,10bR)-3-ethenyl-5,6,10-trihydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one (PubChem CID 56628671) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3R,4aS,5R,6S,6aS,10S,10aS,10bR)-3-ethenyl-5,6,10-trihydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one.
| Compound Name | (3R,4aS,5R,6S,6aS,10S,10aS,10bR)-3-ethenyl-5,6,10-trihydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 56628671 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3R,4aS,5R,6S,6aS,10S,10aS,10bR)-3-ethenyl-5,6,10-trihydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-1-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@H]2[C@](C)(O1)[C@H](O)[C@@H](O)[C@H]1C(C)(C)CC[C@H](O)[C@@]12C |
| InChI | InChI=1S/C20H32O5/c1-7-18(4)10-11(21)14-19(5)12(22)8-9-17(2,3)15(19)13(23)16(24)20(14,6)25-18/h7,12-16,22-24H,1,8-10H2,2-6H3/t12-,13-,14+,15-,16+,18-,19+,20-/m0/s1 |
| InChIKey | WDJJFDJQYGLZPA-FWEVMEMPSA-N |
| XLogP | 1.83 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|