C21H32O6 — CID 24874419
(1S,2S,6S,7S,9R,11R,12S,13S,14R)-9-ethenyl-11,14-dihydroxy-7,9,13,17,17-pentamethyl-3,5,8-trioxatetracyclo[11.4.0.02,6.07,12]heptadecan-4-one (PubChem CID 24874419) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (1S,2S,6S,7S,9R,11R,12S,13S,14R)-9-ethenyl-11,14-dihydroxy-7,9,13,17,17-pentamethyl-3,5,8-trioxatetracyclo[11.4.0.02,6.07,12]heptadecan-4-one.
| Compound Name | (1S,2S,6S,7S,9R,11R,12S,13S,14R)-9-ethenyl-11,14-dihydroxy-7,9,13,17,17-pentamethyl-3,5,8-trioxatetracyclo[11.4.0.02,6.07,12]heptadecan-4-one |
|---|---|
| PubChem CID | 24874419 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1S,2S,6S,7S,9R,11R,12S,13S,14R)-9-ethenyl-11,14-dihydroxy-7,9,13,17,17-pentamethyl-3,5,8-trioxatetracyclo[11.4.0.02,6.07,12]heptadecan-4-one |
| SMILES | C=C[C@@]1(C)C[C@@H](O)[C@H]2[C@](C)(O1)[C@H]1OC(=O)O[C@H]1[C@H]1C(C)(C)CC[C@@H](O)[C@@]12C |
| InChI | InChI=1S/C21H32O6/c1-7-19(4)10-11(22)14-20(5)12(23)8-9-18(2,3)15(20)13-16(21(14,6)27-19)26-17(24)25-13/h7,11-16,22-23H,1,8-10H2,2-6H3/t11-,12-,13+,14-,15+,16+,19+,20-,21+/m1/s1 |
| InChIKey | PVPTWQVWHNPQJE-RMSHNTEDSA-N |
| XLogP | 2.81 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|