C24H41NO8S — CID 70472009
[(3R,4aR,6R,6aS,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] 2-(dimethylamino)acetate;sulfurous acid (PubChem CID 70472009) has the molecular formula C24H41NO8S and a molecular weight of 503.66 g/mol. Its IUPAC name is [(3R,4aR,6R,6aS,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] 2-(dimethylamino)acetate;sulfurous acid.
| Compound Name | [(3R,4aR,6R,6aS,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] 2-(dimethylamino)acetate;sulfurous acid |
|---|---|
| PubChem CID | 70472009 |
| Molecular Formula | C24H41NO8S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | [(3R,4aR,6R,6aS,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] 2-(dimethylamino)acetate;sulfurous acid |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@H]2[C@@]3(C)C(OC(=O)CN(C)C)CCC(C)(C)[C@@H]3[C@H](O)C[C@@]2(C)O1.O=S(O)O |
| InChI | InChI=1S/C24H39NO5.H2O3S/c1-9-22(4)12-15(26)20-23(5,30-22)13-16(27)19-21(2,3)11-10-17(24(19,20)6)29-18(28)14-25(7)8;1-4(2)3/h9,16-17,19-20,27H,1,10-14H2,2-8H3;(H2,1,2,3)/t16-,17?,19+,20+,22+,23-,24+;/m1./s1 |
| InChIKey | LRVWJAWWFNYWEN-RMJIOSGLSA-N |
| XLogP | 2.66 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|