C23H38O5 — CID 24874417
(1R,5R,7R,9S,10S,11S,12S,16S,17S)-7-ethenyl-3,3,7,9,13,13,16-heptamethyl-2,4,8-trioxatetracyclo[7.6.2.05,17.012,16]heptadecane-10,11-diol (PubChem CID 24874417) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (1R,5R,7R,9S,10S,11S,12S,16S,17S)-7-ethenyl-3,3,7,9,13,13,16-heptamethyl-2,4,8-trioxatetracyclo[7.6.2.05,17.012,16]heptadecane-10,11-diol.
| Compound Name | (1R,5R,7R,9S,10S,11S,12S,16S,17S)-7-ethenyl-3,3,7,9,13,13,16-heptamethyl-2,4,8-trioxatetracyclo[7.6.2.05,17.012,16]heptadecane-10,11-diol |
|---|---|
| PubChem CID | 24874417 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (1R,5R,7R,9S,10S,11S,12S,16S,17S)-7-ethenyl-3,3,7,9,13,13,16-heptamethyl-2,4,8-trioxatetracyclo[7.6.2.05,17.012,16]heptadecane-10,11-diol |
| SMILES | C=C[C@@]1(C)C[C@H]2OC(C)(C)O[C@@H]3CCC(C)(C)[C@@H]4[C@H](O)[C@H](O)[C@@](C)(O1)[C@H]2[C@@]34C |
| InChI | InChI=1S/C23H38O5/c1-9-21(6)12-13-16-22(7)14(27-20(4,5)26-13)10-11-19(2,3)17(22)15(24)18(25)23(16,8)28-21/h9,13-18,24-25H,1,10-12H2,2-8H3/t13-,14-,15+,16-,17+,18+,21+,22-,23+/m1/s1 |
| InChIKey | NYQBFZJIZNTSAH-SOUPCIKXSA-N |
| XLogP | 3.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|