C24H39NO8S — CID 18606519
[(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-10-sulfinooxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-5-yl] 2-(dimethylamino)acetate (PubChem CID 18606519) has the molecular formula C24H39NO8S and a molecular weight of 501.64 g/mol. Its IUPAC name is [(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-10-sulfinooxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-5-yl] 2-(dimethylamino)acetate.
| Compound Name | [(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-10-sulfinooxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-5-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 18606519 |
| Molecular Formula | C24H39NO8S |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | [(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-3-ethenyl-6-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-10-sulfinooxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-5-yl] 2-(dimethylamino)acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@H]2[C@](C)(O1)[C@@H](OC(=O)CN(C)C)[C@@H](O)[C@H]1C(C)(C)CC[C@H](OS(=O)O)[C@@]12C |
| InChI | InChI=1S/C24H39NO8S/c1-9-22(4)12-14(26)18-23(5)15(32-34(29)30)10-11-21(2,3)19(23)17(28)20(24(18,6)33-22)31-16(27)13-25(7)8/h9,15,17-20,28H,1,10-13H2,2-8H3,(H,29,30)/t15-,17-,18+,19-,20-,22-,23+,24-/m0/s1 |
| InChIKey | KAPPKIBZVJNIOI-JBETYUFASA-N |
| XLogP | 2.11 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|