C22H14F4N2O — CID 100921636
2-[(4-fluorophenoxy)methyl]-3-phenyl-6-(trifluoromethyl)quinoxaline (PubChem CID 100921636) has the molecular formula C22H14F4N2O and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-3-phenyl-6-(trifluoromethyl)quinoxaline.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-3-phenyl-6-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 100921636 |
| Molecular Formula | C22H14F4N2O |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-3-phenyl-6-(trifluoromethyl)quinoxaline |
| SMILES | Fc1ccc(OCc2nc3ccc(C(F)(F)F)cc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H14F4N2O/c23-16-7-9-17(10-8-16)29-13-20-21(14-4-2-1-3-5-14)28-19-12-15(22(24,25)26)6-11-18(19)27-20/h1-12H,13H2 |
| InChIKey | JGUXSMKKONRCCL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |