C16H7F3N3O- — CID 155554480
(Z)-N-oxido-8-(trifluoromethyl)indeno[1,2-b]quinoxalin-11-imine (PubChem CID 155554480) has the molecular formula C16H7F3N3O- and a molecular weight of 314.25 g/mol. Its IUPAC name is (Z)-N-oxido-8-(trifluoromethyl)indeno[1,2-b]quinoxalin-11-imine.
| Compound Name | (Z)-N-oxido-8-(trifluoromethyl)indeno[1,2-b]quinoxalin-11-imine |
|---|---|
| PubChem CID | 155554480 |
| Molecular Formula | C16H7F3N3O- |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (Z)-N-oxido-8-(trifluoromethyl)indeno[1,2-b]quinoxalin-11-imine |
| SMILES | [O-]/N=C1/c2ccccc2-c2nc3ccc(C(F)(F)F)cc3nc21 |
| InChI | InChI=1S/C16H8F3N3O/c17-16(18,19)8-5-6-11-12(7-8)21-15-13(20-11)9-3-1-2-4-10(9)14(15)22-23/h1-7,23H/p-1/b22-14- |
| InChIKey | ADYJTBFUKDHWQM-HMAPJEAMSA-M |
| XLogP | 3.96 |
| TPSA | 61.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|