C19H16N2O4 — CID 100921778
(11R,15S,16R)-16-(4-methoxyphenyl)-8,13-dioxa-1,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraen-12-one (PubChem CID 100921778) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (11R,15S,16R)-16-(4-methoxyphenyl)-8,13-dioxa-1,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraen-12-one.
| Compound Name | (11R,15S,16R)-16-(4-methoxyphenyl)-8,13-dioxa-1,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraen-12-one |
|---|---|
| PubChem CID | 100921778 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (11R,15S,16R)-16-(4-methoxyphenyl)-8,13-dioxa-1,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraen-12-one |
| SMILES | COc1ccc([C@H]2[C@@H]3COC(=O)[C@@H]3N=C3Oc4ccccc4N32)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-23-12-8-6-11(7-9-12)17-13-10-24-18(22)16(13)20-19-21(17)14-4-2-3-5-15(14)25-19/h2-9,13,16-17H,10H2,1H3/t13-,16-,17+/m1/s1 |
| InChIKey | BFCIRQYLEKBBLF-XYPHTWIQSA-N |
| XLogP | 2.55 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |