C16H17NO — CID 100923139
4,4-dimethyl-2-naphthalen-1-yl-5,6-dihydro-1,3-oxazine (PubChem CID 100923139) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-naphthalen-1-yl-5,6-dihydro-1,3-oxazine.
| Compound Name | 4,4-dimethyl-2-naphthalen-1-yl-5,6-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 100923139 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4,4-dimethyl-2-naphthalen-1-yl-5,6-dihydro-1,3-oxazine |
| SMILES | CC1(C)CCOC(c2cccc3ccccc23)=N1 |
| InChI | InChI=1S/C16H17NO/c1-16(2)10-11-18-15(17-16)14-9-5-7-12-6-3-4-8-13(12)14/h3-9H,10-11H2,1-2H3 |
| InChIKey | XCOUGIQDPSXNLY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |