C11H10N4O2 — CID 100923821
(2E,4E)-2-methyl-5-(7H-purin-6-yl)penta-2,4-dienoic acid (PubChem CID 100923821) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is (2E,4E)-2-methyl-5-(7H-purin-6-yl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-methyl-5-(7H-purin-6-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 100923821 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2E,4E)-2-methyl-5-(7H-purin-6-yl)penta-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\c1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C11H10N4O2/c1-7(11(16)17)3-2-4-8-9-10(14-5-12-8)15-6-13-9/h2-6H,1H3,(H,16,17)(H,12,13,14,15)/b4-2+,7-3+ |
| InChIKey | SEZLPQFQSIRFBX-JKEDICHKSA-N |
| XLogP | 1.40 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|