C24H42O4Si — CID 100924171
tert-butyl (2E,4E,7R)-3,5,7-trimethyl-11-[(2S,3R)-4-oxo-3-trimethylsilyloxetan-2-yl]undeca-2,4-dienoate (PubChem CID 100924171) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is tert-butyl (2E,4E,7R)-3,5,7-trimethyl-11-[(2S,3R)-4-oxo-3-trimethylsilyloxetan-2-yl]undeca-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E,7R)-3,5,7-trimethyl-11-[(2S,3R)-4-oxo-3-trimethylsilyloxetan-2-yl]undeca-2,4-dienoate |
|---|---|
| PubChem CID | 100924171 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl (2E,4E,7R)-3,5,7-trimethyl-11-[(2S,3R)-4-oxo-3-trimethylsilyloxetan-2-yl]undeca-2,4-dienoate |
| SMILES | CC(=C\C(=O)OC(C)(C)C)/C=C(\C)C[C@H](C)CCCC[C@@H]1OC(=O)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-17(12-10-11-13-20-22(23(26)27-20)29(7,8)9)14-18(2)15-19(3)16-21(25)28-24(4,5)6/h15-17,20,22H,10-14H2,1-9H3/b18-15+,19-16+/t17-,20+,22-/m1/s1 |
| InChIKey | KTWLDIZFOQRSEX-APVSBUAMSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|