C32H39NO6 — CID 100926714
(2R,3R,4R,5R,6R)-2-[[(2R)-3,3-dimethylaziridin-2-yl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 100926714) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[[(2R)-3,3-dimethylaziridin-2-yl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[[(2R)-3,3-dimethylaziridin-2-yl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 100926714 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[[(2R)-3,3-dimethylaziridin-2-yl]methoxy]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC1(C)N[C@H]1CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C32H39NO6/c1-32(2)27(33-32)22-38-31-28(34)30(37-20-25-16-10-5-11-17-25)29(36-19-24-14-8-4-9-15-24)26(39-31)21-35-18-23-12-6-3-7-13-23/h3-17,26-31,33-34H,18-22H2,1-2H3/t26-,27+,28-,29-,30-,31-/m1/s1 |
| InChIKey | NYWJASXFJJITIZ-SGTOGCSPSA-N |
| XLogP | 4.23 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|