C8H10O3 — CID 100927912
(4Z)-4-but-3-enylidene-5-methyl-1,3-dioxolan-2-one (PubChem CID 100927912) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (4Z)-4-but-3-enylidene-5-methyl-1,3-dioxolan-2-one.
| Compound Name | (4Z)-4-but-3-enylidene-5-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 100927912 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (4Z)-4-but-3-enylidene-5-methyl-1,3-dioxolan-2-one |
| SMILES | C=CC/C=C1\OC(=O)OC1C |
| InChI | InChI=1S/C8H10O3/c1-3-4-5-7-6(2)10-8(9)11-7/h3,5-6H,1,4H2,2H3/b7-5- |
| InChIKey | WPVVPDCYUQFWMM-ALCCZGGFSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|