C14H26N3O5+ — CID 100928241
2-[2-[[(2Z)-3-carboxy-4-methoxypenta-2,4-dienoyl]oxyamino]ethylamino]ethyl-trimethylazanium (PubChem CID 100928241) has the molecular formula C14H26N3O5+ and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[2-[[(2Z)-3-carboxy-4-methoxypenta-2,4-dienoyl]oxyamino]ethylamino]ethyl-trimethylazanium.
| Compound Name | 2-[2-[[(2Z)-3-carboxy-4-methoxypenta-2,4-dienoyl]oxyamino]ethylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 100928241 |
| Molecular Formula | C14H26N3O5+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[2-[[(2Z)-3-carboxy-4-methoxypenta-2,4-dienoyl]oxyamino]ethylamino]ethyl-trimethylazanium |
| SMILES | C=C(OC)/C(=C/C(=O)ONCCNCC[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H25N3O5/c1-11(21-5)12(14(19)20)10-13(18)22-16-7-6-15-8-9-17(2,3)4/h10,15-16H,1,6-9H2,2-5H3/p+1/b12-10- |
| InChIKey | WKLMZQAARHSQHL-BENRWUELSA-O |
| XLogP | -0.50 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|