C15H19NO4 — CID 100931845
benzyl (2S,3R,3aS)-2-methyl-2,3,3a,4,5,7-hexahydro-[1,2]oxazolo[2,3-c][1,3]oxazine-3-carboxylate (PubChem CID 100931845) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is benzyl (2S,3R,3aS)-2-methyl-2,3,3a,4,5,7-hexahydro-[1,2]oxazolo[2,3-c][1,3]oxazine-3-carboxylate.
| Compound Name | benzyl (2S,3R,3aS)-2-methyl-2,3,3a,4,5,7-hexahydro-[1,2]oxazolo[2,3-c][1,3]oxazine-3-carboxylate |
|---|---|
| PubChem CID | 100931845 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | benzyl (2S,3R,3aS)-2-methyl-2,3,3a,4,5,7-hexahydro-[1,2]oxazolo[2,3-c][1,3]oxazine-3-carboxylate |
| SMILES | C[C@@H]1ON2COCC[C@H]2[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO4/c1-11-14(13-7-8-18-10-16(13)20-11)15(17)19-9-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3/t11-,13-,14-/m0/s1 |
| InChIKey | TTZQSHXDUSTNJW-UBHSHLNASA-N |
| XLogP | 1.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |