C22H25NO5 — CID 12033960
(3aR,4R,5S,7R)-5-methyl-4-phenylmethoxy-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one (PubChem CID 12033960) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (3aR,4R,5S,7R)-5-methyl-4-phenylmethoxy-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one.
| Compound Name | (3aR,4R,5S,7R)-5-methyl-4-phenylmethoxy-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 12033960 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (3aR,4R,5S,7R)-5-methyl-4-phenylmethoxy-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one |
| SMILES | C[C@@H]1O[C@H](COCc2ccccc2)N2OC(=O)C[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c1-16-22(26-14-18-10-6-3-7-11-18)19-12-21(24)28-23(19)20(27-16)15-25-13-17-8-4-2-5-9-17/h2-11,16,19-20,22H,12-15H2,1H3/t16-,19+,20+,22-/m0/s1 |
| InChIKey | QHNZLTPVLDSEQU-DQMRONCHSA-N |
| XLogP | 3.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |