C26H31NO7 — CID 10528318
tert-butyl (3aS,4S,5R,7S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazine-7-carboxylate (PubChem CID 10528318) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is tert-butyl (3aS,4S,5R,7S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazine-7-carboxylate.
| Compound Name | tert-butyl (3aS,4S,5R,7S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazine-7-carboxylate |
|---|---|
| PubChem CID | 10528318 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | tert-butyl (3aS,4S,5R,7S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2CC(=O)ON12 |
| InChI | InChI=1S/C26H31NO7/c1-26(2,3)33-25(29)24-27-20(14-22(28)34-27)23(31-16-19-12-8-5-9-13-19)21(32-24)17-30-15-18-10-6-4-7-11-18/h4-13,20-21,23-24H,14-17H2,1-3H3/t20-,21+,23-,24-/m0/s1 |
| InChIKey | KGGXJRVWNKQVPK-DVKRWUGUSA-N |
| XLogP | 3.39 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |