C23H25NO5 — CID 101040078
[(3aS,6S,7R,7aR)-4-benzyl-2-oxo-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-6-yl] acetate (PubChem CID 101040078) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(3aS,6S,7R,7aR)-4-benzyl-2-oxo-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-6-yl] acetate.
| Compound Name | [(3aS,6S,7R,7aR)-4-benzyl-2-oxo-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-6-yl] acetate |
|---|---|
| PubChem CID | 101040078 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(3aS,6S,7R,7aR)-4-benzyl-2-oxo-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CN(Cc2ccccc2)[C@H]2CC(=O)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H25NO5/c1-16(25)28-20-14-24(13-17-8-4-2-5-9-17)19-12-21(26)29-22(19)23(20)27-15-18-10-6-3-7-11-18/h2-11,19-20,22-23H,12-15H2,1H3/t19-,20-,22+,23+/m0/s1 |
| InChIKey | OMOGMCNEOXNYRU-JFJDKTSWSA-N |
| XLogP | 2.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |