C34H39NO6 — CID 135023769
[(2R,5R)-5-acetyloxy-1-benzyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enylpiperidin-3-yl] acetate (PubChem CID 135023769) has the molecular formula C34H39NO6 and a molecular weight of 557.69 g/mol. Its IUPAC name is [(2R,5R)-5-acetyloxy-1-benzyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enylpiperidin-3-yl] acetate.
| Compound Name | [(2R,5R)-5-acetyloxy-1-benzyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enylpiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 135023769 |
| Molecular Formula | C34H39NO6 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | [(2R,5R)-5-acetyloxy-1-benzyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enylpiperidin-3-yl] acetate |
| SMILES | C=CC[C@@H]1C(OC(C)=O)C(OCc2ccccc2)[C@H](OC(C)=O)C(COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H39NO6/c1-4-14-30-32(40-25(2)36)34(39-23-29-19-12-7-13-20-29)33(41-26(3)37)31(24-38-22-28-17-10-6-11-18-28)35(30)21-27-15-8-5-9-16-27/h4-13,15-20,30-34H,1,14,21-24H2,2-3H3/t30-,31?,32?,33-,34?/m1/s1 |
| InChIKey | FXWURHPTBVHABM-VLAGBEQESA-N |
| XLogP | 5.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|