C34H37NO3 — CID 72707770
(2R)-1-[(1R)-1-phenylethyl]-2-[(1S,2S)-1,2,3-tris(phenylmethoxy)propyl]aziridine (PubChem CID 72707770) has the molecular formula C34H37NO3 and a molecular weight of 507.67 g/mol. Its IUPAC name is (2R)-1-[(1R)-1-phenylethyl]-2-[(1S,2S)-1,2,3-tris(phenylmethoxy)propyl]aziridine.
| Compound Name | (2R)-1-[(1R)-1-phenylethyl]-2-[(1S,2S)-1,2,3-tris(phenylmethoxy)propyl]aziridine |
|---|---|
| PubChem CID | 72707770 |
| Molecular Formula | C34H37NO3 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2R)-1-[(1R)-1-phenylethyl]-2-[(1S,2S)-1,2,3-tris(phenylmethoxy)propyl]aziridine |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]1[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H37NO3/c1-27(31-20-12-5-13-21-31)35-22-32(35)34(38-25-30-18-10-4-11-19-30)33(37-24-29-16-8-3-9-17-29)26-36-23-28-14-6-2-7-15-28/h2-21,27,32-34H,22-26H2,1H3/t27-,32-,33+,34+,35?/m1/s1 |
| InChIKey | AJEFSXLPAAFVCH-KBOMPYSESA-N |
| XLogP | 6.82 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|