C33H37NO6 — CID 11168745
[(2R,3R,4R,5S,6R)-5-acetyloxy-1-benzyl-6-ethenyl-4-phenylmethoxy-2-(phenylmethoxymethyl)piperidin-3-yl] acetate (PubChem CID 11168745) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-acetyloxy-1-benzyl-6-ethenyl-4-phenylmethoxy-2-(phenylmethoxymethyl)piperidin-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-5-acetyloxy-1-benzyl-6-ethenyl-4-phenylmethoxy-2-(phenylmethoxymethyl)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 11168745 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-acetyloxy-1-benzyl-6-ethenyl-4-phenylmethoxy-2-(phenylmethoxymethyl)piperidin-3-yl] acetate |
| SMILES | C=C[C@@H]1[C@H](OC(C)=O)[C@@H](OCc2ccccc2)[C@H](OC(C)=O)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H37NO6/c1-4-29-31(39-24(2)35)33(38-22-28-18-12-7-13-19-28)32(40-25(3)36)30(23-37-21-27-16-10-6-11-17-27)34(29)20-26-14-8-5-9-15-26/h4-19,29-33H,1,20-23H2,2-3H3/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | XFPVSPRRGLSZLW-IZDBAANZSA-N |
| XLogP | 5.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|