C33H37NO8 — CID 11734522
methyl (2S,3aS,4S,5R,6R,7S)-7-(2-methoxy-2-oxoethyl)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate (PubChem CID 11734522) has the molecular formula C33H37NO8 and a molecular weight of 575.66 g/mol. Its IUPAC name is methyl (2S,3aS,4S,5R,6R,7S)-7-(2-methoxy-2-oxoethyl)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aS,4S,5R,6R,7S)-7-(2-methoxy-2-oxoethyl)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11734522 |
| Molecular Formula | C33H37NO8 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | methyl (2S,3aS,4S,5R,6R,7S)-7-(2-methoxy-2-oxoethyl)-4,5,6-tris(phenylmethoxy)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
| SMILES | COC(=O)C[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2C[C@@H](C(=O)OC)ON21 |
| InChI | InChI=1S/C33H37NO8/c1-37-29(35)19-27-31(40-21-24-14-8-4-9-15-24)32(41-22-25-16-10-5-11-17-25)30(39-20-23-12-6-3-7-13-23)26-18-28(33(36)38-2)42-34(26)27/h3-17,26-28,30-32H,18-22H2,1-2H3/t26-,27-,28-,30-,31+,32+/m0/s1 |
| InChIKey | KLGZAVMTMLEJBV-WLELBSQISA-N |
| XLogP | 4.24 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |