C39H45NO6Si — CID 25223735
ethyl (2S,3S,3aS,4R,5R,6R)-3-[dimethyl(phenyl)silyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate (PubChem CID 25223735) has the molecular formula C39H45NO6Si and a molecular weight of 651.88 g/mol. Its IUPAC name is ethyl (2S,3S,3aS,4R,5R,6R)-3-[dimethyl(phenyl)silyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate.
| Compound Name | ethyl (2S,3S,3aS,4R,5R,6R)-3-[dimethyl(phenyl)silyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 25223735 |
| Molecular Formula | C39H45NO6Si |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | ethyl (2S,3S,3aS,4R,5R,6R)-3-[dimethyl(phenyl)silyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1ON2[C@@H]([C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2COCc2ccccc2)[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C39H45NO6Si/c1-4-43-39(41)37-38(47(2,3)32-23-15-8-16-24-32)34-36(45-27-31-21-13-7-14-22-31)35(44-26-30-19-11-6-12-20-30)33(40(34)46-37)28-42-25-29-17-9-5-10-18-29/h5-24,33-38H,4,25-28H2,1-3H3/t33-,34+,35-,36-,37-,38+/m1/s1 |
| InChIKey | ZACQSVYMIQODRK-BCVBWANRSA-N |
| XLogP | 6.29 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|