C39H46NO7+ — CID 90907905
3-[(1R,2S,3S,4S,5S)-5-[(1S)-1,2-bis(phenylmethoxy)ethyl]-1-ethyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-1-ium-2-yl]propanoic acid (PubChem CID 90907905) has the molecular formula C39H46NO7+ and a molecular weight of 640.80 g/mol. Its IUPAC name is 3-[(1R,2S,3S,4S,5S)-5-[(1S)-1,2-bis(phenylmethoxy)ethyl]-1-ethyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-1-ium-2-yl]propanoic acid.
| Compound Name | 3-[(1R,2S,3S,4S,5S)-5-[(1S)-1,2-bis(phenylmethoxy)ethyl]-1-ethyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-1-ium-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90907905 |
| Molecular Formula | C39H46NO7+ |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 3-[(1R,2S,3S,4S,5S)-5-[(1S)-1,2-bis(phenylmethoxy)ethyl]-1-ethyl-1-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-1-ium-2-yl]propanoic acid |
| SMILES | CC[N@+]1(O)[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C39H45NO7/c1-2-40(43)34(23-24-36(41)42)38(46-27-32-19-11-5-12-20-32)39(47-28-33-21-13-6-14-22-33)37(40)35(45-26-31-17-9-4-10-18-31)29-44-25-30-15-7-3-8-16-30/h3-22,34-35,37-39,43H,2,23-29H2,1H3/p+1/t34-,35+,37-,38-,39-,40+/m0/s1 |
| InChIKey | HLZZSZNUYVMIHP-JWQPRNKZSA-O |
| XLogP | 6.80 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|