C47H49NO8 — CID 10887177
(4R)-4-benzyl-3-[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoyl]-1,3-oxazolidin-2-one (PubChem CID 10887177) has the molecular formula C47H49NO8 and a molecular weight of 755.91 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10887177 |
| Molecular Formula | C47H49NO8 |
| Molecular Weight | 755.91 g/mol |
| Exact Mass | 755.35 |
| IUPAC Name | (4R)-4-benzyl-3-[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C47H49NO8/c49-43(48-40(33-55-47(48)50)28-35-16-6-1-7-17-35)27-26-41-44(52-30-37-20-10-3-11-21-37)46(54-32-39-24-14-5-15-25-39)45(53-31-38-22-12-4-13-23-38)42(56-41)34-51-29-36-18-8-2-9-19-36/h1-25,40-42,44-46H,26-34H2/t40-,41+,42-,44+,45+,46-/m1/s1 |
| InChIKey | FQNHRSUJBSHQSB-PAEWBYFYSA-N |
| XLogP | 8.10 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.91 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |