C42H41NO7 — CID 126961871
dibenzyl (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)piperidine-1,2-dicarboxylate (PubChem CID 126961871) has the molecular formula C42H41NO7 and a molecular weight of 671.79 g/mol. Its IUPAC name is dibenzyl (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)piperidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126961871 |
| Molecular Formula | C42H41NO7 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | dibenzyl (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)piperidine-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C42H41NO7/c44-41(49-30-35-22-12-4-13-23-35)38-40(48-29-34-20-10-3-11-21-34)39(47-28-33-18-8-2-9-19-33)37(46-27-32-16-6-1-7-17-32)26-43(38)42(45)50-31-36-24-14-5-15-25-36/h1-25,37-40H,26-31H2/t37-,38-,39+,40+/m0/s1 |
| InChIKey | DFTIBATXQSAVLD-JPYDVTDNSA-N |
| XLogP | 7.51 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |