C53H61FN2O9 — CID 58018259
benzyl 2-[[6-[[2-fluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]amino]-2-methylhexanoyl]amino]propanoate (PubChem CID 58018259) has the molecular formula C53H61FN2O9 and a molecular weight of 889.07 g/mol. Its IUPAC name is benzyl 2-[[6-[[2-fluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]amino]-2-methylhexanoyl]amino]propanoate.
| Compound Name | benzyl 2-[[6-[[2-fluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]amino]-2-methylhexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 58018259 |
| Molecular Formula | C53H61FN2O9 |
| Molecular Weight | 889.07 g/mol |
| Exact Mass | 888.44 |
| IUPAC Name | benzyl 2-[[6-[[2-fluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetyl]amino]-2-methylhexanoyl]amino]propanoate |
| SMILES | CC(CCCCNC(=O)C(F)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(=O)NC(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C53H61FN2O9/c1-38(51(57)56-39(2)53(59)64-36-44-29-16-7-17-30-44)20-18-19-31-55-52(58)46(54)48-50(63-35-43-27-14-6-15-28-43)49(62-34-42-25-12-5-13-26-42)47(61-33-41-23-10-4-11-24-41)45(65-48)37-60-32-40-21-8-3-9-22-40/h3-17,21-30,38-39,45-50H,18-20,31-37H2,1-2H3,(H,55,58)(H,56,57)/t38?,39?,45-,46?,47-,48+,49+,50+/m1/s1 |
| InChIKey | FYXJBNLIQSGUHE-UKMPERSCSA-N |
| XLogP | 8.24 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.07 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|