C42H47F2NO5 — CID 157039741
[4-(difluoromethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone (PubChem CID 157039741) has the molecular formula C42H47F2NO5 and a molecular weight of 683.84 g/mol. Its IUPAC name is [4-(difluoromethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(difluoromethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 157039741 |
| Molecular Formula | C42H47F2NO5 |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 683.34 |
| IUPAC Name | [4-(difluoromethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCC(C(F)F)CC1)N1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C42H47F2NO5/c43-41(44)35-21-23-36(24-22-35)42(46)45-25-38(48-27-32-15-7-2-8-16-32)40(50-29-34-19-11-4-12-20-34)39(49-28-33-17-9-3-10-18-33)37(45)30-47-26-31-13-5-1-6-14-31/h1-20,35-41H,21-30H2/t35?,36?,37-,38-,39+,40+/m0/s1 |
| InChIKey | JRZYJSVYACYWHE-RWUKPRLCSA-N |
| XLogP | 8.24 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |