C35H35NO7 — CID 126961874
(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (PubChem CID 126961874) has the molecular formula C35H35NO7 and a molecular weight of 581.67 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 126961874 |
| Molecular Formula | C35H35NO7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H35NO7/c37-34(38)31-33(42-24-28-17-9-3-10-18-28)32(41-23-27-15-7-2-8-16-27)30(40-22-26-13-5-1-6-14-26)21-36(31)35(39)43-25-29-19-11-4-12-20-29/h1-20,30-33H,21-25H2,(H,37,38)/t30-,31-,32+,33+/m0/s1 |
| InChIKey | JYSUTUGPADGGDO-UYEZAFAQSA-N |
| XLogP | 5.85 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |