C36H37NO5 — CID 134836477
(2R,3R,4R,5R,6S)-3,4-bis(phenylmethoxy)-2,6-bis(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 134836477) has the molecular formula C36H37NO5 and a molecular weight of 563.69 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-3,4-bis(phenylmethoxy)-2,6-bis(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2R,3R,4R,5R,6S)-3,4-bis(phenylmethoxy)-2,6-bis(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 134836477 |
| Molecular Formula | C36H37NO5 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | (2R,3R,4R,5R,6S)-3,4-bis(phenylmethoxy)-2,6-bis(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1[C@H](COCc2ccccc2)[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C36H37NO5/c38-36-31(25-39-21-27-13-5-1-6-14-27)33-35(42-24-30-19-11-4-12-20-30)34(41-23-29-17-9-3-10-18-29)32(37(33)36)26-40-22-28-15-7-2-8-16-28/h1-20,31-35H,21-26H2/t31-,32-,33-,34-,35-/m1/s1 |
| InChIKey | ADTSFLVCZVEPAJ-ZQPTVKGJSA-N |
| XLogP | 5.80 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |