C33H37NO6 — CID 134836528
(2S,3R,4R,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 134836528) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,3R,4R,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 134836528 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)OC[C@@H]([C@@H]2C(=O)N3[C@@H]2[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]3COCc2ccccc2)O1 |
| InChI | InChI=1S/C33H37NO6/c1-33(2)39-22-27(40-33)28-29-31(38-20-25-16-10-5-11-17-25)30(37-19-24-14-8-4-9-15-24)26(34(29)32(28)35)21-36-18-23-12-6-3-7-13-23/h3-17,26-31H,18-22H2,1-2H3/t26-,27-,28-,29-,30+,31+/m0/s1 |
| InChIKey | OHMGNCSWXGPARI-CGSNJSCMSA-N |
| XLogP | 4.73 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |