C33H39NO6 — CID 134836472
(2S,3S,4S,5S,6R)-6-(diethoxymethyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 134836472) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-(diethoxymethyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,3S,4S,5S,6R)-6-(diethoxymethyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 134836472 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-(diethoxymethyl)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CCOC(OCC)[C@@H]1C(=O)N2[C@@H]1[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2COCc1ccccc1 |
| InChI | InChI=1S/C33H39NO6/c1-3-37-33(38-4-2)28-29-31(40-22-26-18-12-7-13-19-26)30(39-21-25-16-10-6-11-17-25)27(34(29)32(28)35)23-36-20-24-14-8-5-9-15-24/h5-19,27-31,33H,3-4,20-23H2,1-2H3/t27-,28-,29-,30-,31-/m0/s1 |
| InChIKey | WPPPTLHAZQDDBX-QKUYTOGTSA-N |
| XLogP | 4.98 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|