C26H31NO5 — CID 134836529
(2S,3S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 134836529) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2S,3S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,3S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 134836529 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2S,3S,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)OC[C@@H]([C@@H]2C(=O)N3[C@@H]2C[C@H](OCc2ccccc2)[C@@H]3COCc2ccccc2)O1 |
| InChI | InChI=1S/C26H31NO5/c1-26(2)31-17-23(32-26)24-20-13-22(30-15-19-11-7-4-8-12-19)21(27(20)25(24)28)16-29-14-18-9-5-3-6-10-18/h3-12,20-24H,13-17H2,1-2H3/t20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | KUHLETBLZVBMNG-LYCSZFELSA-N |
| XLogP | 3.54 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |