C32H41NO7 — CID 10626519
(4S)-4-benzyl-3-[(2S)-2-[(4S,5S,6R)-6-[[(2R,4R,6S)-4-methoxy-6-methyloxan-2-yl]methyl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]propanoyl]-1,3-oxazolidin-2-one (PubChem CID 10626519) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(4S,5S,6R)-6-[[(2R,4R,6S)-4-methoxy-6-methyloxan-2-yl]methyl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(4S,5S,6R)-6-[[(2R,4R,6S)-4-methoxy-6-methyloxan-2-yl]methyl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10626519 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(4S,5S,6R)-6-[[(2R,4R,6S)-4-methoxy-6-methyloxan-2-yl]methyl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]propanoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@H]1C[C@H](C[C@H]2OC(c3ccccc3)O[C@H]([C@H](C)C(=O)N3C(=O)OC[C@@H]3Cc3ccccc3)[C@H]2C)O[C@@H](C)C1 |
| InChI | InChI=1S/C32H41NO7/c1-20-15-26(36-4)17-27(38-20)18-28-21(2)29(40-31(39-28)24-13-9-6-10-14-24)22(3)30(34)33-25(19-37-32(33)35)16-23-11-7-5-8-12-23/h5-14,20-22,25-29,31H,15-19H2,1-4H3/t20-,21-,22-,25-,26+,27+,28+,29-,31?/m0/s1 |
| InChIKey | ZGEBCAUQBAFJRV-DISMQROJSA-N |
| XLogP | 5.30 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |