C49H52BrNO8 — CID 10952982
(4R)-4-benzyl-3-[(2R,3S)-2-bromo-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one (PubChem CID 10952982) has the molecular formula C49H52BrNO8 and a molecular weight of 862.86 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-2-bromo-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-2-bromo-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10952982 |
| Molecular Formula | C49H52BrNO8 |
| Molecular Weight | 862.86 g/mol |
| Exact Mass | 861.29 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-2-bromo-3-methyl-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)[C@@H](Br)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C49H52BrNO8/c1-35(44(50)48(52)51-41(33-58-49(51)53)28-36-17-7-2-8-18-36)27-42-45(55-30-38-21-11-4-12-22-38)47(57-32-40-25-15-6-16-26-40)46(56-31-39-23-13-5-14-24-39)43(59-42)34-54-29-37-19-9-3-10-20-37/h2-26,35,41-47H,27-34H2,1H3/t35-,41+,42-,43+,44+,45-,46-,47+/m0/s1 |
| InChIKey | NYGSLQYVJGFBDX-NAHYTFGJSA-N |
| XLogP | 9.11 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.86 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|