C37H41NO5Si — CID 25223736
(1S,2S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-2-hydroxy-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 25223736) has the molecular formula C37H41NO5Si and a molecular weight of 607.82 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-2-hydroxy-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,2S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-2-hydroxy-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 25223736 |
| Molecular Formula | C37H41NO5Si |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | (1S,2S,5R,6R,7R,8S)-1-[dimethyl(phenyl)silyl]-2-hydroxy-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2C(=O)[C@@H]1O |
| InChI | InChI=1S/C37H41NO5Si/c1-44(2,30-21-13-6-14-22-30)36-32-35(43-25-29-19-11-5-12-20-29)34(42-24-28-17-9-4-10-18-28)31(38(32)37(40)33(36)39)26-41-23-27-15-7-3-8-16-27/h3-22,31-36,39H,23-26H2,1-2H3/t31-,32+,33-,34-,35-,36+/m1/s1 |
| InChIKey | CJOYAUVORKMTLN-BAKSPFSNSA-N |
| XLogP | 5.31 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|