C47H53NO9Si — CID 11251368
benzyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-methoxy-3-oxopropyl]-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate (PubChem CID 11251368) has the molecular formula C47H53NO9Si and a molecular weight of 804.03 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-methoxy-3-oxopropyl]-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-methoxy-3-oxopropyl]-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11251368 |
| Molecular Formula | C47H53NO9Si |
| Molecular Weight | 804.03 g/mol |
| Exact Mass | 803.35 |
| IUPAC Name | benzyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-methoxy-3-oxopropyl]-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C47H53NO9Si/c1-47(2,3)58(37-26-16-8-17-27-37,38-28-18-9-19-29-38)57-33-39-43(54-30-34-20-10-5-11-21-34)44(55-31-35-22-12-6-13-23-35)40(41(49)42(50)45(51)53-4)48(39)46(52)56-32-36-24-14-7-15-25-36/h5-29,39-44,49-50H,30-33H2,1-4H3/t39-,40-,41-,42+,43-,44-/m1/s1 |
| InChIKey | CWLMQBJJZNYYKT-PZIBQTSGSA-N |
| XLogP | 6.02 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.03 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|