C42H51NO6Si — CID 25112697
(4R)-4-benzyl-3-[(2R,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,6-dimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 25112697) has the molecular formula C42H51NO6Si and a molecular weight of 693.96 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,6-dimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,6-dimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25112697 |
| Molecular Formula | C42H51NO6Si |
| Molecular Weight | 693.96 g/mol |
| Exact Mass | 693.35 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,6-dimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](COCc1ccccc1)[C@H](C[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H51NO6Si/c1-31(28-47-29-34-20-12-7-13-21-34)39(49-50(42(3,4)5,36-22-14-8-15-23-36)37-24-16-9-17-25-37)27-38(44)32(2)40(45)43-35(30-48-41(43)46)26-33-18-10-6-11-19-33/h6-25,31-32,35,38-39,44H,26-30H2,1-5H3/t31-,32-,35-,38+,39+/m1/s1 |
| InChIKey | OKYSKGMOIDPIFZ-DSHSWJNRSA-N |
| XLogP | 6.76 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.96 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|