C45H53NO5Si — CID 53391476
(4S)-4-benzyl-3-[(1R,2S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-(3-phenylmethoxypropyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 53391476) has the molecular formula C45H53NO5Si and a molecular weight of 716.01 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(1R,2S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-(3-phenylmethoxypropyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(1R,2S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-(3-phenylmethoxypropyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53391476 |
| Molecular Formula | C45H53NO5Si |
| Molecular Weight | 716.01 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | (4S)-4-benzyl-3-[(1R,2S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-2-(3-phenylmethoxypropyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1C[C@@H](C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)[C@@H](CCCOCc2ccccc2)C=C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H53NO5Si/c1-34-28-42(43(47)46-39(33-50-44(46)48)29-35-18-9-5-10-19-35)37(22-17-27-49-31-36-20-11-6-12-21-36)30-38(34)32-51-52(45(2,3)4,40-23-13-7-14-24-40)41-25-15-8-16-26-41/h5-16,18-21,23-26,30,34,37,39,42H,17,22,27-29,31-33H2,1-4H3/t34-,37-,39-,42+/m0/s1 |
| InChIKey | UHBVSWQLIYRBKN-WXUJUBGHSA-N |
| XLogP | 8.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.01 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|