C27H33NO6 — CID 132557259
(2S,4R,5S,6S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethyl-7-phenylmethoxyheptane-1,3-dione (PubChem CID 132557259) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is (2S,4R,5S,6S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethyl-7-phenylmethoxyheptane-1,3-dione.
| Compound Name | (2S,4R,5S,6S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethyl-7-phenylmethoxyheptane-1,3-dione |
|---|---|
| PubChem CID | 132557259 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (2S,4R,5S,6S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethyl-7-phenylmethoxyheptane-1,3-dione |
| SMILES | C[C@@H](C(=O)[C@H](C)[C@@H](O)[C@@H](C)COCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H33NO6/c1-18(15-33-16-22-12-8-5-9-13-22)24(29)19(2)25(30)20(3)26(31)28-23(17-34-27(28)32)14-21-10-6-4-7-11-21/h4-13,18-20,23-24,29H,14-17H2,1-3H3/t18-,19+,20-,23-,24-/m0/s1 |
| InChIKey | KSQNSYZGDUKLQD-MLNGRUJYSA-N |
| XLogP | 3.63 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|