C51H57NO11 — CID 134969787
benzyl 4-[1,2-dihydroxy-3-oxo-4-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134969787) has the molecular formula C51H57NO11 and a molecular weight of 860.01 g/mol. Its IUPAC name is benzyl 4-[1,2-dihydroxy-3-oxo-4-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 4-[1,2-dihydroxy-3-oxo-4-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134969787 |
| Molecular Formula | C51H57NO11 |
| Molecular Weight | 860.01 g/mol |
| Exact Mass | 859.39 |
| IUPAC Name | benzyl 4-[1,2-dihydroxy-3-oxo-4-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)OCC(C(O)C(O)C(=O)C[C@H]2OC(COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C51H57NO11/c1-51(2)52(50(56)61-33-40-26-16-7-17-27-40)41(34-62-51)45(54)46(55)42(53)28-43-47(58-30-37-20-10-4-11-21-37)49(60-32-39-24-14-6-15-25-39)48(59-31-38-22-12-5-13-23-38)44(63-43)35-57-29-36-18-8-3-9-19-36/h3-27,41,43-49,54-55H,28-35H2,1-2H3/t41?,43-,44?,45?,46?,47?,48-,49?/m1/s1 |
| InChIKey | SFNOBAJBDJUHIN-BYFLRLBRSA-N |
| XLogP | 7.18 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.01 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |